Organic acids and derivatives
Filtered Search Results
Methyl cyclopentanecarboxylate, 97%
CAS: 4630-80-2 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.17 MDL Number: MFCD00019290 InChI Key: IIHIJFJSXPDTNO-UHFFFAOYSA-N Synonym: cyclopentanecarboxylic acid, methyl ester,cyclopentanecarboxylic acid methyl ester,methyl cyclopentanoate,acmc-1am5n,methylcyclopentanecarboxylate,methylcyclopentane carboxylate,methyl cyclopentane carboxylate,methyl-1-cyclopentanecarboxylate,cyclopentanoic acid methyl ester,cyclopentanecarboxylic acid methyl PubChem CID: 78365 IUPAC Name: methyl cyclopentanecarboxylate SMILES: COC(=O)C1CCCC1
| PubChem CID | 78365 |
|---|---|
| CAS | 4630-80-2 |
| Molecular Weight (g/mol) | 128.17 |
| MDL Number | MFCD00019290 |
| SMILES | COC(=O)C1CCCC1 |
| Synonym | cyclopentanecarboxylic acid, methyl ester,cyclopentanecarboxylic acid methyl ester,methyl cyclopentanoate,acmc-1am5n,methylcyclopentanecarboxylate,methylcyclopentane carboxylate,methyl cyclopentane carboxylate,methyl-1-cyclopentanecarboxylate,cyclopentanoic acid methyl ester,cyclopentanecarboxylic acid methyl |
| IUPAC Name | methyl cyclopentanecarboxylate |
| InChI Key | IIHIJFJSXPDTNO-UHFFFAOYSA-N |
| Molecular Formula | C7H12O2 |
Chloroacetic acid, 99+%, ACS reagent
CAS: 79-11-8 Molecular Formula: C2H3ClO2 Molecular Weight (g/mol): 94.5 InChI Key: FOCAUTSVDIKZOP-UHFFFAOYSA-N Synonym: chloroacetic acid,monochloroacetic acid,chloracetic acid,acetic acid, chloro,acide chloracetique,chloroethanoic acid,monochloroethanoic acid,monochloracetic acid,monochloorazijnzuur,monochloressigsaeure PubChem CID: 300 ChEBI: CHEBI:27869 IUPAC Name: 2-chloroacetic acid SMILES: C(C(=O)O)Cl
| PubChem CID | 300 |
|---|---|
| CAS | 79-11-8 |
| Molecular Weight (g/mol) | 94.5 |
| ChEBI | CHEBI:27869 |
| SMILES | C(C(=O)O)Cl |
| Synonym | chloroacetic acid,monochloroacetic acid,chloracetic acid,acetic acid, chloro,acide chloracetique,chloroethanoic acid,monochloroethanoic acid,monochloracetic acid,monochloorazijnzuur,monochloressigsaeure |
| IUPAC Name | 2-chloroacetic acid |
| InChI Key | FOCAUTSVDIKZOP-UHFFFAOYSA-N |
| Molecular Formula | C2H3ClO2 |
4-(Tetrazol-5-yl)phenylboronic acid, 97%
CAS: 179942-55-3 Molecular Formula: C7H7BN4O2 Molecular Weight (g/mol): 189.97 MDL Number: MFCD06739099 MFCD11044435 InChI Key: DXUPJOQUAAVAGV-UHFFFAOYSA-N Synonym: 4-2h-tetrazol-5-yl phenyl boronic acid,4-2h-tetrazol-5-yl phenylboronic acid,4-tetrazol-5-yl phenylboronic acid,4-2h-tetrazol-5-yl-phenylboronic acid,4-1h-tetrazol-5-yl-phenylboronic acid,4-2h-1,2,3,4-tetrazol-5-yl phenyl boronic acid,4-1h-1,2,3,4-tetrazol-5-yl phenylboronic acid,4-2h-1,2,3,4-tetrazol-5-yl phenylboronic acid,4-1htetrazol-5-yl phenylboronic acid PubChem CID: 46737995 IUPAC Name: [4-(2H-tetrazol-5-yl)phenyl]boronic acid SMILES: OB(O)C1=CC=C(C=C1)C1=NNN=N1
| PubChem CID | 46737995 |
|---|---|
| CAS | 179942-55-3 |
| Molecular Weight (g/mol) | 189.97 |
| MDL Number | MFCD06739099 MFCD11044435 |
| SMILES | OB(O)C1=CC=C(C=C1)C1=NNN=N1 |
| Synonym | 4-2h-tetrazol-5-yl phenyl boronic acid,4-2h-tetrazol-5-yl phenylboronic acid,4-tetrazol-5-yl phenylboronic acid,4-2h-tetrazol-5-yl-phenylboronic acid,4-1h-tetrazol-5-yl-phenylboronic acid,4-2h-1,2,3,4-tetrazol-5-yl phenyl boronic acid,4-1h-1,2,3,4-tetrazol-5-yl phenylboronic acid,4-2h-1,2,3,4-tetrazol-5-yl phenylboronic acid,4-1htetrazol-5-yl phenylboronic acid |
| IUPAC Name | [4-(2H-tetrazol-5-yl)phenyl]boronic acid |
| InChI Key | DXUPJOQUAAVAGV-UHFFFAOYSA-N |
| Molecular Formula | C7H7BN4O2 |
Benzoylurea, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 614-22-2
| CAS | 614-22-2 |
|---|
4-Sulfamoylbenzoic Acid, 95+ Percent, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 138-41-0
| CAS | 138-41-0 |
|---|
N-(4-Oxocyclohexyl)acetamide, 98%
CAS: 27514-08-5 Molecular Formula: C8H13NO2 Molecular Weight (g/mol): 155.197 MDL Number: MFCD03703462 InChI Key: WZEMYWNHKFIVKE-UHFFFAOYSA-N Synonym: n-4-oxocyclohexyl acetamide,4-acetamidocyclohexanone,4-acetamido-cyclohexanone,4-acetylamino cyclohexanone,4-n-acetylamino cyclohexanone,4-n-acetyl-amino-cyclohexanone,n-4-oxo-cyclohexyl-acetamide,acetamide, n-4-oxocyclohexyl,4-aminocyclohexanone, n-acetyl PubChem CID: 538565 IUPAC Name: N-(4-oxocyclohexyl)acetamide SMILES: CC(=O)NC1CCC(=O)CC1
| PubChem CID | 538565 |
|---|---|
| CAS | 27514-08-5 |
| Molecular Weight (g/mol) | 155.197 |
| MDL Number | MFCD03703462 |
| SMILES | CC(=O)NC1CCC(=O)CC1 |
| Synonym | n-4-oxocyclohexyl acetamide,4-acetamidocyclohexanone,4-acetamido-cyclohexanone,4-acetylamino cyclohexanone,4-n-acetylamino cyclohexanone,4-n-acetyl-amino-cyclohexanone,n-4-oxo-cyclohexyl-acetamide,acetamide, n-4-oxocyclohexyl,4-aminocyclohexanone, n-acetyl |
| IUPAC Name | N-(4-oxocyclohexyl)acetamide |
| InChI Key | WZEMYWNHKFIVKE-UHFFFAOYSA-N |
| Molecular Formula | C8H13NO2 |
Methyl cyclopentanecarboxylate, 97%
CAS: 4630-80-2 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.17 MDL Number: MFCD00019290 InChI Key: IIHIJFJSXPDTNO-UHFFFAOYSA-N Synonym: cyclopentanecarboxylic acid, methyl ester,cyclopentanecarboxylic acid methyl ester,methyl cyclopentanoate,acmc-1am5n,methylcyclopentanecarboxylate,methylcyclopentane carboxylate,methyl cyclopentane carboxylate,methyl-1-cyclopentanecarboxylate,cyclopentanoic acid methyl ester,cyclopentanecarboxylic acid methyl PubChem CID: 78365 IUPAC Name: methyl cyclopentanecarboxylate SMILES: COC(=O)C1CCCC1
| PubChem CID | 78365 |
|---|---|
| CAS | 4630-80-2 |
| Molecular Weight (g/mol) | 128.17 |
| MDL Number | MFCD00019290 |
| SMILES | COC(=O)C1CCCC1 |
| Synonym | cyclopentanecarboxylic acid, methyl ester,cyclopentanecarboxylic acid methyl ester,methyl cyclopentanoate,acmc-1am5n,methylcyclopentanecarboxylate,methylcyclopentane carboxylate,methyl cyclopentane carboxylate,methyl-1-cyclopentanecarboxylate,cyclopentanoic acid methyl ester,cyclopentanecarboxylic acid methyl |
| IUPAC Name | methyl cyclopentanecarboxylate |
| InChI Key | IIHIJFJSXPDTNO-UHFFFAOYSA-N |
| Molecular Formula | C7H12O2 |
Methyl indole-3-carboxylate, 99%
CAS: 942-24-5 Molecular Formula: C10H9NO2 Molecular Weight (g/mol): 175.187 MDL Number: MFCD00189407 InChI Key: QXAUTQFAWKKNLM-UHFFFAOYSA-N Synonym: methyl indole-3-carboxylate,indole-3-carboxylic acid methyl ester,methyl 3-indolecarboxylate,1h-indole-3-carboxylic acid methyl ester,1h-indole-3-carboxylic acid, methyl ester,3-carbomethoxyindole,3-methoxycarbonylindole,methylindole-3-carboxylate,indole-3-carboxylic acid, methyl ester,methyl-3-indolcarboxylate PubChem CID: 589098 ChEBI: CHEBI:65019 IUPAC Name: methyl 1H-indole-3-carboxylate SMILES: COC(=O)C1=CNC2=CC=CC=C21
| PubChem CID | 589098 |
|---|---|
| CAS | 942-24-5 |
| Molecular Weight (g/mol) | 175.187 |
| ChEBI | CHEBI:65019 |
| MDL Number | MFCD00189407 |
| SMILES | COC(=O)C1=CNC2=CC=CC=C21 |
| Synonym | methyl indole-3-carboxylate,indole-3-carboxylic acid methyl ester,methyl 3-indolecarboxylate,1h-indole-3-carboxylic acid methyl ester,1h-indole-3-carboxylic acid, methyl ester,3-carbomethoxyindole,3-methoxycarbonylindole,methylindole-3-carboxylate,indole-3-carboxylic acid, methyl ester,methyl-3-indolcarboxylate |
| IUPAC Name | methyl 1H-indole-3-carboxylate |
| InChI Key | QXAUTQFAWKKNLM-UHFFFAOYSA-N |
| Molecular Formula | C10H9NO2 |
Diethyl 1-octylphosphonate, 98%
CAS: 1068-07-1 Molecular Formula: C12H27O3P Molecular Weight (g/mol): 250.319 MDL Number: MFCD00015659 InChI Key: MVDVRXOWIPONFY-UHFFFAOYSA-N Synonym: diethyl octylphosphonate,diethyl 1-octylphosphonate,phosphonic acid, octyl-, diethyl ester,acmc-1bsbo,octylphosphonic acid diethyl ester,diethyl 1-octylphosphonate, 98+%,octyl-phosphonic acid diethyl ester,phosphonic acid,p-octyl-, diethyl ester,phosphonic acid, p-octyl-, diethyl ester PubChem CID: 70604 IUPAC Name: 1-diethoxyphosphoryloctane SMILES: CCCCCCCCP(=O)(OCC)OCC
| PubChem CID | 70604 |
|---|---|
| CAS | 1068-07-1 |
| Molecular Weight (g/mol) | 250.319 |
| MDL Number | MFCD00015659 |
| SMILES | CCCCCCCCP(=O)(OCC)OCC |
| Synonym | diethyl octylphosphonate,diethyl 1-octylphosphonate,phosphonic acid, octyl-, diethyl ester,acmc-1bsbo,octylphosphonic acid diethyl ester,diethyl 1-octylphosphonate, 98+%,octyl-phosphonic acid diethyl ester,phosphonic acid,p-octyl-, diethyl ester,phosphonic acid, p-octyl-, diethyl ester |
| IUPAC Name | 1-diethoxyphosphoryloctane |
| InChI Key | MVDVRXOWIPONFY-UHFFFAOYSA-N |
| Molecular Formula | C12H27O3P |
Valeric acid hydrazide, 95%
CAS: 38291-82-6 Molecular Formula: C5H12N2O Molecular Weight (g/mol): 116.164 MDL Number: MFCD00025137 InChI Key: PJBQYCIDGYKEMN-UHFFFAOYSA-N Synonym: valeric acid hydrazide,pentanohydrazide,valerohydrazide,pentanoic acid, hydrazide,pentanoic acid hydrazide,valerylhydrazine,pentanoic acid,hydrazide,acmc-1afhr PubChem CID: 93202 IUPAC Name: pentanehydrazide SMILES: CCCCC(=O)NN
| PubChem CID | 93202 |
|---|---|
| CAS | 38291-82-6 |
| Molecular Weight (g/mol) | 116.164 |
| MDL Number | MFCD00025137 |
| SMILES | CCCCC(=O)NN |
| Synonym | valeric acid hydrazide,pentanohydrazide,valerohydrazide,pentanoic acid, hydrazide,pentanoic acid hydrazide,valerylhydrazine,pentanoic acid,hydrazide,acmc-1afhr |
| IUPAC Name | pentanehydrazide |
| InChI Key | PJBQYCIDGYKEMN-UHFFFAOYSA-N |
| Molecular Formula | C5H12N2O |
Benzo[b]thiophene-3-acetic acid, 98+%
CAS: 1131-09-5 Molecular Formula: C10H8O2S Molecular Weight (g/mol): 192.232 MDL Number: MFCD00051637 InChI Key: VFZQJKXVHYZXMM-UHFFFAOYSA-N Synonym: benzo b thiophene-3-acetic acid,benzo b thiophen-3-yl acetic acid,3-benzo b thienylacetic acid,acetic acid, 3-benzo b thienyl,2-benzo b thiophen-3-yl acetic acid,2-benzo b thiophen-3-ylacetic acid,benzothiophene-3-acetic acid,2-1-benzothiophen-3-yl acetic acid,3-benzo b thiopheneacetic acid PubChem CID: 70799 IUPAC Name: 2-(1-benzothiophen-3-yl)acetic acid SMILES: C1=CC=C2C(=C1)C(=CS2)CC(=O)O
| PubChem CID | 70799 |
|---|---|
| CAS | 1131-09-5 |
| Molecular Weight (g/mol) | 192.232 |
| MDL Number | MFCD00051637 |
| SMILES | C1=CC=C2C(=C1)C(=CS2)CC(=O)O |
| Synonym | benzo b thiophene-3-acetic acid,benzo b thiophen-3-yl acetic acid,3-benzo b thienylacetic acid,acetic acid, 3-benzo b thienyl,2-benzo b thiophen-3-yl acetic acid,2-benzo b thiophen-3-ylacetic acid,benzothiophene-3-acetic acid,2-1-benzothiophen-3-yl acetic acid,3-benzo b thiopheneacetic acid |
| IUPAC Name | 2-(1-benzothiophen-3-yl)acetic acid |
| InChI Key | VFZQJKXVHYZXMM-UHFFFAOYSA-N |
| Molecular Formula | C10H8O2S |
(Aminomethyl)phosphonic acid, 99%
CAS: 1066-51-9 Molecular Formula: CH6NO3P Molecular Weight (g/mol): 111.037 MDL Number: MFCD00008105 InChI Key: MGRVRXRGTBOSHW-UHFFFAOYSA-N Synonym: aminomethyl phosphonic acid,aminomethanephosphonic acid,amep,1-aminomethylphosphonic acid,1-aminomethylphosphonate,amino methane phosphoric acid,caswell no. 037c,1-aminomethyl phosphonic acid,phosphonic acid, aminomethyl PubChem CID: 14017 ChEBI: CHEBI:28812 IUPAC Name: aminomethylphosphonic acid SMILES: C(N)P(=O)(O)O
| PubChem CID | 14017 |
|---|---|
| CAS | 1066-51-9 |
| Molecular Weight (g/mol) | 111.037 |
| ChEBI | CHEBI:28812 |
| MDL Number | MFCD00008105 |
| SMILES | C(N)P(=O)(O)O |
| Synonym | aminomethyl phosphonic acid,aminomethanephosphonic acid,amep,1-aminomethylphosphonic acid,1-aminomethylphosphonate,amino methane phosphoric acid,caswell no. 037c,1-aminomethyl phosphonic acid,phosphonic acid, aminomethyl |
| IUPAC Name | aminomethylphosphonic acid |
| InChI Key | MGRVRXRGTBOSHW-UHFFFAOYSA-N |
| Molecular Formula | CH6NO3P |
Allyl chloroacetate, 98%
CAS: 2916-14-5 Molecular Formula: C5H7ClO2 Molecular Weight (g/mol): 134.559 MDL Number: MFCD00058936 InChI Key: VMBJJCDVORDOCF-UHFFFAOYSA-N Synonym: allyl chloroacetate,allyl 2-chloroacetate,chloroacetic acid allyl ester,acetic acid, chloro-, 2-propenyl ester,prop-2-en-1-yl 2-chloroacetate,acetic acid, chloro-, allyl ester,allyl monochloroacetate,acmc-1cffa,chloroacetic acid,2-propenyl ester PubChem CID: 76206 IUPAC Name: prop-2-enyl 2-chloroacetate SMILES: C=CCOC(=O)CCl
| PubChem CID | 76206 |
|---|---|
| CAS | 2916-14-5 |
| Molecular Weight (g/mol) | 134.559 |
| MDL Number | MFCD00058936 |
| SMILES | C=CCOC(=O)CCl |
| Synonym | allyl chloroacetate,allyl 2-chloroacetate,chloroacetic acid allyl ester,acetic acid, chloro-, 2-propenyl ester,prop-2-en-1-yl 2-chloroacetate,acetic acid, chloro-, allyl ester,allyl monochloroacetate,acmc-1cffa,chloroacetic acid,2-propenyl ester |
| IUPAC Name | prop-2-enyl 2-chloroacetate |
| InChI Key | VMBJJCDVORDOCF-UHFFFAOYSA-N |
| Molecular Formula | C5H7ClO2 |
Methyl cyclopropanecarboxylate, 98%
CAS: 2868-37-3 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.12 MDL Number: MFCD00001280 InChI Key: PKAHQJNJPDVTDP-UHFFFAOYSA-N Synonym: methyl cyclopropane carboxylate,cyclopropanecarboxylic acid, methyl ester,methylcyclopropanecarboxylate,cyclopropanecarboxylic acid methyl ester,methyl cyclopropylcarboxylate,unii-5uq53f585u,mcpc,pubchem11835,ksc490a7l,1-methylcyclopropanecarboxylate PubChem CID: 76122 IUPAC Name: methyl cyclopropanecarboxylate SMILES: COC(=O)C1CC1
| PubChem CID | 76122 |
|---|---|
| CAS | 2868-37-3 |
| Molecular Weight (g/mol) | 100.12 |
| MDL Number | MFCD00001280 |
| SMILES | COC(=O)C1CC1 |
| Synonym | methyl cyclopropane carboxylate,cyclopropanecarboxylic acid, methyl ester,methylcyclopropanecarboxylate,cyclopropanecarboxylic acid methyl ester,methyl cyclopropylcarboxylate,unii-5uq53f585u,mcpc,pubchem11835,ksc490a7l,1-methylcyclopropanecarboxylate |
| IUPAC Name | methyl cyclopropanecarboxylate |
| InChI Key | PKAHQJNJPDVTDP-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
4-Hydroxybenzoic Acid Hydrazide, 98%
CAS: 5351-23-5 Molecular Formula: C7H8N2O2 Molecular Weight (g/mol): 152.15 MDL Number: MFCD00007605 InChI Key: ZMZGIVVRBMFZSG-UHFFFAOYSA-N Synonym: 4-hydroxybenzhydrazide,4-hydroxybenzoic acid hydrazide,4-hydroxybenzoic hydrazide,p-hydroxybenzhydrazide,p-hydroxybenzoic acid hydrazide,4-hydroxybenzoylhydrazine,benzoic acid, 4-hydroxy-, hydrazide,p-hydroxybenzoic hydrazide,p-hydroxybenzoyl hydrazine,4-hydroxy-benzoic acid hydrazide PubChem CID: 1742 IUPAC Name: 4-hydroxybenzohydrazide SMILES: C1=CC(=CC=C1C(=O)NN)O
| PubChem CID | 1742 |
|---|---|
| CAS | 5351-23-5 |
| Molecular Weight (g/mol) | 152.15 |
| MDL Number | MFCD00007605 |
| SMILES | C1=CC(=CC=C1C(=O)NN)O |
| Synonym | 4-hydroxybenzhydrazide,4-hydroxybenzoic acid hydrazide,4-hydroxybenzoic hydrazide,p-hydroxybenzhydrazide,p-hydroxybenzoic acid hydrazide,4-hydroxybenzoylhydrazine,benzoic acid, 4-hydroxy-, hydrazide,p-hydroxybenzoic hydrazide,p-hydroxybenzoyl hydrazine,4-hydroxy-benzoic acid hydrazide |
| IUPAC Name | 4-hydroxybenzohydrazide |
| InChI Key | ZMZGIVVRBMFZSG-UHFFFAOYSA-N |
| Molecular Formula | C7H8N2O2 |